Добавить материал и получить бесплатное свидетельство о публикации в СМИ
Эл. №ФС77-60625 от 20.01.2015
Инфоурок / Химия / Конспекты / Контрольная работа. За I-четверть. 10 класс.
ВНИМАНИЮ ВСЕХ УЧИТЕЛЕЙ: согласно Федеральному закону № 313-ФЗ все педагоги должны пройти обучение навыкам оказания первой помощи.

Дистанционный курс "Оказание первой помощи детям и взрослым" от проекта "Инфоурок" даёт Вам возможность привести свои знания в соответствие с требованиями закона и получить удостоверение о повышении квалификации установленного образца (180 часов). Начало обучения новой группы: 24 мая.

Подать заявку на курс
  • Химия

Контрольная работа. За I-четверть. 10 класс.

библиотека
материалов

Контрольная работа.

За I-четверть.

10 класс.

I-вариант.



1. Напишите уравнения реакций, при помощи которых можно осуществить следующие превращения:

FeCl2 → Fe(OH)2 → FeSO4 → Fe → FeCl2.


2. Вычислите количество меди, выделившейся при взаимодействии 12 гр. железных опилок и раствора, содержащего

18,8 гр. нитрата меди (II).


3. Окислительно-восстановительные реакции.

(расставьте коэффициенты методом электронного баланса)


Na2S + Na2Cr2O7 + H2SO4 → S + Cr2(SO4)3 + Na2SO4 + H2O.


Al + KClO4 + H2SO4 hello_html_m6b7fc4d1.gif KCl + Al2(SO4)3 + H2O.


4. Растворы каких веществ надо взять для осуществления следующих реакций:(Запишите молекулярные и полные ионные уравнения)

Ca2+ + CO32- → CaCO3↓.

Ba2+ + SO42- → BaSO4↓.


5. Как и почему изменяются свойства химических элементов в пределах одной главной подгруппы? Рассмотрите эту закономерность на примере: элементов III группы.




Контрольная работа.

За I-четверть.

10 класс.

II-вариант.



1. Напишите уравнения реакций, при помощи которых можно осуществить следующие превращения:

PP2O5H3PO4Na3PO4Ca3(PO4)2.


2. Какая масса осадка карбоната кальция выделится при сливании избытка раствора карбоната натрия и раствора, содержащего 0,1 моль гидроксида кальция?.


3. Окислительно-восстановительные реакции.

(расставьте коэффициенты методом электронного баланса)


KI + KMnO4 + H2SO4 → I2 + MnSO4 + K2SO4 + H2O.


NaClO + Kl + H2SO4 hello_html_m6b7fc4d1.gif NaCl + I2 + K2SO4 + H2O.


4. Растворы каких веществ надо взять для осуществления следующих реакций: (Запишите молекулярные и полные ионные уравнения)

Mg2+ + 2OH- → Mg(OH)2↓.

2PO43- + 3Mn2+ → Mn3(PO4)2↓.


5. Как и почему изменяются свойства химических элементов в пределах одной главной подгруппы? Рассмотрите эту закономерность на примере: элементов VI группы.




Краткое описание документа:

Контрольная работа.

За I-четверть.

10 класс.

I-вариант.

 

 

1. Напишите уравнения реакций, при помощи которых можно осуществить следующие превращения:

FeCl2 → Fe(OH)2 → FeSO4 → Fe → FeCl2.

 

2. Вычислите количество меди, выделившейся при взаимодействии 12 гр. железных опилок и раствора, содержащего

18,8 гр. нитрата меди (II).

 

3. Окислительно-восстановительные реакции.

(расставьте коэффициенты методом электронного баланса)

 

Na2S + Na2Cr2O7 + H2SO4 → S + Cr2(SO4)3 + Na2SO4 + H2O.

 

Al + KClO4 + H2SO4 KCl + Al2(SO4)3 + H2O.

 

4. Растворы каких веществ надо взять для осуществления следующих реакций:(Запишите молекулярные и полные ионные уравнения)

Ca2+ + CO32- → CaCO3↓.

Ba2+ + SO42- → BaSO4↓.

 

5. Как и почему изменяются свойства химических элементов в пределах одной главной подгруппы? Рассмотрите эту закономерность на примере: элементов IIIгруппы.

 

 

 

Контрольная работа.

За I-четверть.

10 класс.

II-вариант.

 

 

1. Напишите уравнения реакций, при помощи которых можно осуществить следующие превращения:

PP2O5H3PO4Na3PO4Ca3(PO4)2.

 

2. Какая масса осадка карбоната кальция выделится при сливании избытка раствора карбоната натрия и раствора, содержащего 0,1 моль гидроксида кальция?.

 

3. Окислительно-восстановительные реакции.

(расставьте коэффициенты методом электронного баланса)

 

KI + KMnO4 + H2SO4 → I2 + MnSO4 + K2SO4 + H2O.

 

NaClO + Kl + H2SO4  NaCl + I2 + K2SO4 + H2O.

 

4. Растворы каких веществ надо взять для осуществления следующих реакций: (Запишите молекулярные и полные ионные уравнения)

Mg2+ + 2OH- → Mg(OH)2↓.

2PO43- + 3Mn2+ → Mn3(PO4)2↓.

 

5. Как и почему изменяются свойства химических элементов в пределах одной главной подгруппы? Рассмотрите эту закономерность на примере: элементов VI группы.

 

 

Автор
Дата добавления 22.11.2014
Раздел Химия
Подраздел Конспекты
Просмотров1008
Номер материала 146319
Получить свидетельство о публикации

Выберите специальность, которую Вы хотите получить:

Обучение проходит дистанционно на сайте проекта "Инфоурок".
По итогам обучения слушателям выдаются печатные дипломы установленного образца.

ПЕРЕЙТИ В КАТАЛОГ КУРСОВ

Похожие материалы

Включите уведомления прямо сейчас и мы сразу сообщим Вам о важных новостях. Не волнуйтесь, мы будем отправлять только самое главное.
Специальное предложение
Вверх