Инфоурок / Химия / Другие методич. материалы / Справочная информация "окислительно-восстановительные реакции"

Справочная информация "окислительно-восстановительные реакции"


Напоминаем, что в соответствии с профстандартом педагога (утверждён Приказом Минтруда России), если у Вас нет соответствующего преподаваемому предмету образования, то Вам необходимо пройти профессиональную переподготовку по профилю педагогической деятельности. Сделать это Вы можете дистанционно на сайте проекта "Инфоурок" и получить диплом с присвоением квалификации уже через 2 месяца!

Только сейчас действует СКИДКА 50% для всех педагогов на все 184 курса профессиональной переподготовки! Доступна рассрочка с первым взносом всего 10%, при этом цена курса не увеличивается из-за использования рассрочки!

ВЫБРАТЬ КУРС И ПОДАТЬ ЗАЯВКУ
библиотека
материалов

ОКИСЛИТЕЛЬНО-ВОССТАНОВИТЕЛЬНЫЕ РЕАКЦИИ



ОВР - химические реакции, в которых происходит изменение степеней окисления атомов, входящих в состав реагирующих веществ.


Окисление – процесс отдачи электронов атомом.

H20 - 2ē 2H+

S-2 - 2ē S0


Восстановление – процесс присоединения электронов атомом.

Mn+4 + 2ē Mn+2

S0 + 2ē S-2


Окислитель – атом, который принимает электроны.


Восстановитель – атом, который отдаёт электроны.



Степень окисления атомов элементов простых веществ равна нулю


Mg0, Сl20, O20


Степень окисления водорода в соединениях +1, кроме гидридов


+1 +1 -1

HCl, H2O, NaH


Степень окисления кислорода в соединениях -2, кроме пероксидов и соединений с фтором



-2 -1 +2

H2O, H 2О2, OF2


Сумма всех степеней окисления атомов в соединении равна нулю



+1+6 -2

H 2SO4

2(+1)+6+4(-2)=0


Сумма всех степеней окисления атомов в ионе равна значению заряда иона



+6 -2

SO4

6+4(-2)= -2





Распознавание окислительно – восстановительных реакций

Запишите значения степеней окисления атомов всех элементов в уравнении реакции.

Определите, изменяется ли степень окисления атомов элементов.

+2 -2 +1 -1 +2 -1 +1 -2

PbO + 2HClPbCl2 + H2O

Степень окисления не изменяется => реакция не окислительно-восстановительная


+4 -2 +1 -1 +2 -1 0 +1 -2

PbO2 + 2HCl → PbCl2 + Cl2 + 2H2O


Степень окисления изменяется => реакция окислительно-восстановительная





Окислители

Восстановители

Галогены.

Перманганат калия (KMnO4)

Манганат калия (K2MnO4)

Оксид марганца (IV) (MnO2)

Дихромат калия (K2Cr2O7)

Хромат калия (K2CrO4)

Азотная кислота (HNO3)

Серная кислота (H2SO4) конц.

Оксид меди(II) (CuO)

Оксид свинца(IV) (PbO2)

Оксид серебра (Ag2O)

Пероксид водорода (H2O2)

Хлорид железа(III) (FeCl3)

Бертоллетова соль (KClO3)

Анод при электролизе


Металлы

Водород

Уголь

Окись углерода (II) (CO)

Сероводород (H2S)

Оксид серы (IV) (SO2)

Сернистая кислота H2SO3 и ее соли

Галогеноводородные кислоты и их соли

Катионы металлов в низших степенях окисления: SnCl2, FeCl2, MnSO4, Cr2(SO4)3

Азотистая кислота HNO2

Аммиак NH3

Гидразин NH2NH2

Оксид азота(II) (NO)

Катод при электролизе.





Межмолекулярные окислительно-восстановительные реакции

 

Окислитель и восстановитель находятся в разных веществах; обмен электронами в этих реакциях происходит между различными атомами или молекулами:

 




S0 + O20 S+4O2-2


S - восстановитель;

O2 - окислитель

 

Cu+2O + C+2O Cu0 + C+4O2


CO - восстановитель;

CuO - окислитель

 

Zn0 + 2HCl Zn+2Cl2 + H20­


Zn - восстановитель;

HСl - окислитель

 

Mn+4O2 + 2KI-1 + 2H2SO4    I20 + K2SO4 + Mn+2SO4 + 2H2O


KI - восстановитель;

MnO2 - окислитель.

 

Сюда же относятся реакции между веществами, в которых атомы одного и того же элемента имеют разные степени окисления:

 

2H2S -2 + H2S+4O3 3S0 + 3H2O


Внутримолекулярные окислительно- восстановительные реакции

 

Во внутримолекулярных реакциях окислитель и восстановитель находятся в одной и той же молекуле. Внутримолекулярные реакции протекают, как правило, при термическом разложении веществ, содержащих окислитель и восстановитель.

 

2KCl+5O3-2 2KCl-1 + 3O20­


Cl+5 - окислитель;

О-2 - восстановитель

 

N-3H4N+5O3  –t N2+1O­ + 2H2O


N+5 - окислитель;

N-3 - восстановитель

 

2Pb(N+5O3-2)2 2PbO + 4N+4O2 + O20­


N+5 - окислитель;

O-2 - восстановитель

 


Диспропорционирование





Окислительно-восстановительная реакция, в которой один элемент одновременно повышает и понижает степень окисления.

 






Cl20 + 2KOH K Cl+1O + K Cl-1 + H2O


3K2 Mn+6O4 + 2H2O 2KMn+7O4 + Mn+4O2 + 4KOH


3H N+3O2 H N+5O3 + 2N+2O­ + H2O


2N+4O2 + 2KOH K N+5O3 + KN+3O2 + H2O




Составление уравнений окислительно-восстановительных реакций


A    Электронный баланс - метод нахождения коэффициентов в уравнениях окислительно-восстановительных реакций, в котором рассматривается обмен электронами между атомами элементов, изменяющих свою степень окисления. Число электронов, отданное восстановителем равно числу электронов, получаемых окислителем.

 

Уравнение составляется в несколько стадий:

 

1.      Записывают схему реакции.

 

KMnO4 + HCl KCl + MnCl2 + Cl2­ + H2O

 

2.      Проставляют степени окисления над знаками элементов, которые меняются.

 

KMn+7O4 + HCl-1 KCl + Mn+2Cl2 + Cl20­ + H2O

 

3.      Выделяют элементы, изменяющие степени окисления и определяют число электронов, приобретенных окислителем и отдаваемых восстановителем.

 

Mn+7 + 5ē Mn+2

2Cl-1 - 2ē Cl20

 

4.      Уравнивают число приобретенных и отдаваемых электронов, устанавливая тем самым коэффициенты для соединений, в которых присутствуют элементы, изменяющие степень окисления.

 

2Mn+7 + 10Cl-1 2Mn+2 + 5Cl20

 

5.      Подбирают коэффициенты для всех остальных участников реакции.

 

2KMn+7O4 + 16HCl-1 2KCl + 2Mn+2Cl2 + 5Cl20 + 8H2O











 

B      Электронно-ионный баланс (метод полуреакций) метод нахождения коэффициентов, в котором рассматривается обмен электронами между ионами в растворе с учетом характера среды:

 

10Cl- + 2MnO41- + 16H+ 5Cl20­ + 2Mn2+ + 8H2O

(для уравнивания ионной полуреакции используют H+, OH- или воду)

 

Типичные реакции окисления-восстановления

 

Реакции с участием перманганата калия в качестве окислителя

 

При взаимодействии перманганата калия с восстановителем образуются различные продукты восстановления в зависимости от pH среды.

 

Реакции в кислой среде.

 

5K2S+4O3 + 2KMn+7O4 + 3H2SO4 6K2S+6O4 + 2Mn+2SO4 + 3H2O

 

электронный баланс

метод полуреакций

2MnO4- + 16H+ + 5SO32- + 5H2O 2Mn2+ + 8H2O + 5SO42- + 10H+

или 2MnO4- + 6H+ + 5SO32- 2Mn2+ + 3H2O + 5SO42-

 

Фиолетовый раствор KMnO4 обесцвечивается при добавлении раствора K2SO3.

 
Реакции в нейтральной среде

 

3K2S+4O3 + 2KMn+7O4 + H2O 3K2S+6O4 +2Mn+4O2 + 2KOH

 

электронный баланс

метод полуреакций:

2MnO4- + 4H2O + 3SO32- + 6OH- 2MnO2 + 8OH- + 3SO42- + 3H2O

или 2MnO4- + H2O + 3SO32- 2MnO2 + 2OH- + 3SO42-

 

Фиолетовый раствор KMnO4 после окончания реакции обесцвечивается и наблюдается выпадение бурого осадка.

 

Реакции в щелочной среде.

 

K2S+4O3 + 2KMn+7O4 + 2KOH K2S+6O4 +2K2Mn+6O4 + H2O

 

электронный баланс

метод полуреакций:

SO32- + 2OH- + 2MnO4- SO42- + H2O + 2MnO42-

 

Фиолетовый раствор KMnO4 превращается в зеленоватый раствор K2MnO4.

Таким образом,

hello_html_63e45e7b.png

 

Реакции с дихроматом калия в качестве окислителя

 

Степень окисления хрома понижается с +6 до +3. Наблюдается изменение окраски реакционной массы с желто-оранжевого цвета до зеленого или фиолетового.

 

1)      

K2Cr2+6O7 + 3H2S-2 + 4H2SO4 K2SO4 + Cr2+3(SO4)3 + 3S0 + 7H2O

 

электронный баланс:

метод полуреакций:

Cr2O72- + 8H+ + 3H2S 2Cr3+ + 7H2O + 3S0

 

2)      

K2Cr2+6O7 + 6Fe+2SO4 + 7H2SO4 3Fe2+3(SO4)3 + K2SO4 + Cr2+3(SO4)3 + 7H2O

 

электронный баланс:

метод полуреакций:

6Fe2+ + Cr2O72- + 14H+ 2Cr3+ + 6Fe3+ + 7H2O

 

3)      

K2Cr2+6O7 + 14HCl-1 3Cl20­ + 2KCl + 2Cr+3Cl3 + 7H2O

 

электронный баланс:

метод полуреакций:

Cr2O72- + 6Cl- + 14H+ 2Cr3+ + 3Cl20 + 7H2O

 

Окислительные свойства азотной кислоты

 

Окислителем в молекуле азотной кислоты является N+5, который в зависимости от концентрации HNO3 и силы восстановителя (например, активности металла - см. также тему " Азотная кислота") принимает от 1 до 8 электронов, образуя
N+4O2N+2ON2+1ON20N-3H3(NH4NO3);

 

1)      

Cu0 + 4HN+5O3(конц.) Cu+2(NO3)2 + 2N+4O2­ + 2H2O

 

электронный баланс:

метод полуреакций:

Cu0 + 2NO3- + 4H+ Cu2+ + 2NO2 + 2H2O

 

2)      

3Ag0 + 4HN+5O3(конц.) 3Ag+1NO3 + N+2O­ + 2H2O

 

электронный баланс:

метод полуреакций:

3Ag0 + NO3- + 4H+ 3Ag+ + NO + 2H2O

 

3)      

5Co0 + 12HN+5O3(разб.) 5Co+2(NO3)2 + N20­ + 6H2O

 

электронный баланс:

метод полуреакций:

5Co0 + 2NO3- + 12H+ 5Co2+ + N2 + 6H2O

 

4)      

4Ca0 + 10HN+5O3(сильн. разб.) 4Ca+2(NO3)2 + N-3H4NO3 + 3H2O

 

электронный баланс:

метод полуреакций:

4Ca0 + NO3- + 10H+ 4Ca2+ + NH4+ + 3H2O

 

При взаимодействии HNO3 с неметаллами выделяется, как правило, NO:

 

1)      

3C0 + 4HN+5O3 3C+4O2­ + 4N+2O­ + 2H2O

 

электронный баланс:

3C0 + 6H2O + 4NO3- + 16H+ 3CO2 + 12H+ + 4NO + 8H2O

или 3C0 + 4NO3- + 4H+ 3CO2 + 4NO + 2H2O

 

2)      

3P0 + 5HN+5O3 + 2H2O 3H3P+5O4 + 5N+2O­

 

электронный баланс:

3P0 + 12H2O + 5NO3- + 20H+ 3PO43- + 24H+ + 5NO + 10H2O

или 3P0 + 2H2O + 5NO3- 3PO43- + 4H+ + 5NO

 

Пероксид водорода в окислительно-восстановительных реакциях

 

1.      Обычно пероксид водорода используют как окислитель:

 

H2O2 + 2HI-1 I20 + 2H2O

 

электронный баланс:

метод полуреакций:

2I- + H2O2 + 2H+ I2 + 2H2O

 

При действии сильных окислителей пероксид водорода может окисляться, образуя кислород и воду.

 

5H2O2 + 2KMn+7O4 + 3H2SO4 5O20­ + K2SO4 + 2Mn2+SO4 + 8H2O

 

электронный баланс:

метод полуреакций:

2MnO4- + 5H2O2 + 16H+ 2Mn2+ + 8H2O + 5O2 + 10H+

или 2MnO4- + 5H2O2 + 6H+ 2Mn2+ + 8H2O + 5O2


9


Общая информация

Номер материала: ДБ-343927


Очень низкие цены на курсы переподготовки от Московского учебного центра для педагогов

Специально для учителей, воспитателей и других работников системы образования действуют 60% скидки (только до конца зимы) при обучении на курсах профессиональной переподготовки (124 курса на выбор).

После окончания обучения выдаётся диплом о профессиональной переподготовке установленного образца с присвоением квалификации (признаётся при прохождении аттестации по всей России).

Подайте заявку на интересующий Вас курс сейчас: KURSY.ORG

Похожие материалы

Только до конца зимы! Скидка 60% для педагогов на ДИПЛОМЫ от Столичного учебного центра!

Курсы профессиональной переподготовки и повышения квалификации от 1 400 руб.
Для выбора курса воспользуйтесь удобным поиском на сайте KURSY.ORG


Вы получите официальный Диплом или Удостоверение установленного образца в соответствии с требованиями государства (образовательная Лицензия № 038767 выдана ООО "Столичный учебный центр" Департаментом образования города МОСКВЫ).

Московские документы для аттестации: KURSY.ORG


Вам будут интересны эти курсы:

Курс повышения квалификации «Химия окружающей среды»
Курс профессиональной переподготовки «Химия: теория и методика преподавания в образовательной организации»
Курс «Правовое обеспечение деятельности коммерческой организации и индивидуальных предпринимателей»
Курс «Гид-экскурсовод: Основы туристского сопровождения»
Курс повышения квалификации «Педагогическая риторика в условиях реализации ФГОС»
Курс повышения квалификации «Нанотехнологии и наноматериалы в биологии. Нанобиотехнологическая продукция»
Курс повышения квалификации «Основы построения коммуникаций в организации»
Курс повышения квалификации «Организация практики студентов в соответствии с требованиями ФГОС технических направлений подготовки»
Курс повышения квалификации «Управление финансами: как уйти от банкротства»
Курс повышения квалификации «Особенности подготовки к сдаче ОГЭ по химии в условиях реализации ФГОС ООО»
Курс профессиональной переподготовки «Биология и химия: теория и методика преподавания в образовательной организации»
Курс повышения квалификации «Современные образовательные технологии в преподавании химии с учетом ФГОС»
Курс профессиональной переподготовки «Метрология, стандартизация и сертификация»
Курс профессиональной переподготовки «Техническое сопровождение технологических процессов переработки нефти и газа»
Курс профессиональной переподготовки «Организация системы учета и мониторинга обращения с отходами производства и потребления»