Добавить материал и получить бесплатное свидетельство о публикации в СМИ
Эл. №ФС77-60625 от 20.01.2015
Инфоурок / Химия / Презентации / Презентационное сопровождение урока химии по теме "Типы химических реакций" (8 класс)

Презентационное сопровождение урока химии по теме "Типы химических реакций" (8 класс)

Международный конкурс по математике «Поверь в себя»

для учеников 1-11 классов и дошкольников с ЛЮБЫМ уровнем знаний

Задания конкурса по математике «Поверь в себя» разработаны таким образом, чтобы каждый ученик вне зависимости от уровня подготовки смог проявить себя.

К ОПЛАТЕ ЗА ОДНОГО УЧЕНИКА: ВСЕГО 28 РУБ.

Конкурс проходит полностью дистанционно. Это значит, что ребенок сам решает задания, сидя за своим домашним компьютером (по желанию учителя дети могут решать задания и организованно в компьютерном классе).

Подробнее о конкурсе - https://urokimatematiki.ru/


Идёт приём заявок на самые массовые международные олимпиады проекта "Инфоурок"

Для учителей мы подготовили самые привлекательные условия в русскоязычном интернете:

1. Бесплатные наградные документы с указанием данных образовательной Лицензии и Свидeтельства СМИ;
2. Призовой фонд 1.500.000 рублей для самых активных учителей;
3. До 100 рублей за одного ученика остаётся у учителя (при орг.взносе 150 рублей);
4. Бесплатные путёвки в Турцию (на двоих, всё включено) - розыгрыш среди активных учителей;
5. Бесплатная подписка на месяц на видеоуроки от "Инфоурок" - активным учителям;
6. Благодарность учителю будет выслана на адрес руководителя школы.

Подайте заявку на олимпиаду сейчас - https://infourok.ru/konkurs

  • Химия

Документы в архиве:

1.93 МБ 8 класс.ppt
24.82 МБ ЗОЛОТОЙ ДОЖДЬ - ХИМИЧЕСКАЯ РЕАКЦИЯ.mp4

Название документа 8 класс.ppt

«Химическое превращение, химическая реакция есть главный предмет химии». Н. Н...
ПОВТОРИМ! Что такое химическая реакция? Перечислите признаки протекания просм...
АЛГОРИТМ НАПИСАНИЯ ХИМИЧЕСКОЙ РЕАКЦИИ 1. В левой части уравнения пишут формул...
КАКИЕ ЯВЛЕНИЯ ОТНОСЯТСЯ К (Ф) ФИЗИЧЕСКИМ, А КАКИЕ К (Х) ХИМИЧЕСКИМ. кипение в...
РАССТАВИТЬ КОЭФФИЦИЕНТЫ KClO3 = KCl + O2 Al + S = Al2S3 Zn + HCl = ZnCl2 + H2...
ПРОВЕРИМ! Ф – 1, 2, 5, 8, 10 Х – 3, 4, 6, 7, 9 «5» - без ошибок, «4» - 1-2 ош...
2KClO3 = 2KCl + 3O2 2Al + 3S = Al2S3 Zn + 2HCl = ZnCl2 + H2 CaCO3 + 2HNO3 =Ca...
КЛАССИФИКАЦИЯ ХИМИЧЕСКИХ РЕАКЦИЙ
Классификация – распределение объектов и явлений по классам, группам на осно...
РЕАКЦИИ СОЕДИНЕНИЯ 2H2 + O2 2H2O несколько веществ одно более сложное веществ...
РЕАКЦИИ РАЗЛОЖЕНИЯ Cu(OH)2 CuO + H2O одно сложное вещество несколько веществ...
РЕАКЦИИ ЗАМЕЩЕНИЯ Fe + CuSO4 FeSO4 + Cu ПРОСТОЕ ВЕЩЕСТВО СЛОЖНОЕ ВЕЩЕСТВО Реа...
РЕАКЦИИ ОБМЕНА BaCl2+H2SO4 BaSO4+ 2HCl Реакциями обмена называют реакции, при...
2KClO3 = 2KCl + 3O2 2Al + 3S = Al2S3 Zn + 2HCl = ZnCl2 + H2 CaCO3 + 2HNO3 =Ca...
ЗАКРЕПИМ! P2O5 + H2O =2HPO3 2Fe(OH)3 = Fe2O3 + 3H2O 2KClO3 = 2KCl + 3O2 2Al +...
ОБОБЩИМ! ХИМИЧЕСКИЕ РЕАКЦИИ НОВЫЕ ВЕЩЕСТВА ПРИЗНАКИ цвет газ осадок запах теп...
ДОМАШНЕЕ ЗАДАНИЕ § 13, учебник и тетрадь
УКАЗАТЬ ТИП ХИМИЧЕСКИХ РЕАКЦИЙ, РАССТАВИТЬ КОЭФФИЦИЕНТЫ. P+O2=P2O5 H2O2= H2O...
СПАСИБО ЗА ВНИМАНИЕ!
1 из 20

Описание презентации по отдельным слайдам:

№ слайда 1 «Химическое превращение, химическая реакция есть главный предмет химии». Н. Н
Описание слайда:

«Химическое превращение, химическая реакция есть главный предмет химии». Н. Н. Семёнов

№ слайда 2 ПОВТОРИМ! Что такое химическая реакция? Перечислите признаки протекания просм
Описание слайда:

ПОВТОРИМ! Что такое химическая реакция? Перечислите признаки протекания просмотренной химической реакции. Какие условия необходимы для возникновения данной химической реакции? Запишем схему этой реакции… Можем ли мы утверждать, что в нашей записи выполняется закон сохранения массы? Закон сохранения массы сформулировал… Сейчас этот закон формулируется … На практике закон используется при …

№ слайда 3 АЛГОРИТМ НАПИСАНИЯ ХИМИЧЕСКОЙ РЕАКЦИИ 1. В левой части уравнения пишут формул
Описание слайда:

АЛГОРИТМ НАПИСАНИЯ ХИМИЧЕСКОЙ РЕАКЦИИ 1. В левой части уравнения пишут формулы веществ, вступивших в реакцию (исходные вещества), а затем ставят стрелку. KI + Pb(NO3)2 2. В правой части (после стрелки) пишут формулы веществ, образующихся в результате реакции (продукты реакции). KI + Pb(NO3)2 KNO3 + PbI2 3. Уравнение реакции составляют на основе закона сохранения массы веществ, т.е. слева и справа должно быть одинаковое число атомов, что достигается расстановкой коэффициентов перед формулами веществ. 2 KI + Pb(NO3)2 = 2 KNO3 + PbI2 4. Затем проверяют число атомов каждого элемента в левой и правой частях уравнения.

№ слайда 4 КАКИЕ ЯВЛЕНИЯ ОТНОСЯТСЯ К (Ф) ФИЗИЧЕСКИМ, А КАКИЕ К (Х) ХИМИЧЕСКИМ. кипение в
Описание слайда:

КАКИЕ ЯВЛЕНИЯ ОТНОСЯТСЯ К (Ф) ФИЗИЧЕСКИМ, А КАКИЕ К (Х) ХИМИЧЕСКИМ. кипение воды, образование на деревьях инея, скисание молока, ржавление гвоздя, таяние льда, горение бенгальских огней, гниение растений, приготовление сахарной пудры из сахара, горение свечи, растворение соли.

№ слайда 5 РАССТАВИТЬ КОЭФФИЦИЕНТЫ KClO3 = KCl + O2 Al + S = Al2S3 Zn + HCl = ZnCl2 + H2
Описание слайда:

РАССТАВИТЬ КОЭФФИЦИЕНТЫ KClO3 = KCl + O2 Al + S = Al2S3 Zn + HCl = ZnCl2 + H2 CaCO3 + HNO3 =Ca(NO3)2 + H2CO3

№ слайда 6 ПРОВЕРИМ! Ф – 1, 2, 5, 8, 10 Х – 3, 4, 6, 7, 9 «5» - без ошибок, «4» - 1-2 ош
Описание слайда:

ПРОВЕРИМ! Ф – 1, 2, 5, 8, 10 Х – 3, 4, 6, 7, 9 «5» - без ошибок, «4» - 1-2 ошибки, «3» - 3-4 ошибки. 2KClO3 = 2KCl + 3O2 2Al + 3S = Al2S3 Zn + 2HCl = ZnCl2 + H2 CaCO3 + 2HNO3 =Ca(NO3)2 + H2CO3

№ слайда 7 2KClO3 = 2KCl + 3O2 2Al + 3S = Al2S3 Zn + 2HCl = ZnCl2 + H2 CaCO3 + 2HNO3 =Ca
Описание слайда:

2KClO3 = 2KCl + 3O2 2Al + 3S = Al2S3 Zn + 2HCl = ZnCl2 + H2 CaCO3 + 2HNO3 =Ca(NO3)2 + H2CO3 ПОДУМАЙ…

№ слайда 8 КЛАССИФИКАЦИЯ ХИМИЧЕСКИХ РЕАКЦИЙ
Описание слайда:

КЛАССИФИКАЦИЯ ХИМИЧЕСКИХ РЕАКЦИЙ

№ слайда 9 Классификация – распределение объектов и явлений по классам, группам на осно
Описание слайда:

Классификация – распределение объектов и явлений по классам, группам на основе их общих признаков. КЛАССИФИКАЦИЯ ХИМИЧЕСКИХ РЕАКЦИЙ ПО ЧИСЛУ И СОСТАВУ ИСХОДНЫХ И  ПОЛУЧЕННЫХ ВЕЩЕСТВ

№ слайда 10
Описание слайда:

№ слайда 11 РЕАКЦИИ СОЕДИНЕНИЯ 2H2 + O2 2H2O несколько веществ одно более сложное веществ
Описание слайда:

РЕАКЦИИ СОЕДИНЕНИЯ 2H2 + O2 2H2O несколько веществ одно более сложное вещество Реакциями соединения называют реакции, при которых из нескольких веществ образуется одно более сложное вещество

№ слайда 12 РЕАКЦИИ РАЗЛОЖЕНИЯ Cu(OH)2 CuO + H2O одно сложное вещество несколько веществ
Описание слайда:

РЕАКЦИИ РАЗЛОЖЕНИЯ Cu(OH)2 CuO + H2O одно сложное вещество несколько веществ Реакциями разложения называют реакции, при которых из одного сложного вещества образуется несколько новых веществ.

№ слайда 13 РЕАКЦИИ ЗАМЕЩЕНИЯ Fe + CuSO4 FeSO4 + Cu ПРОСТОЕ ВЕЩЕСТВО СЛОЖНОЕ ВЕЩЕСТВО Реа
Описание слайда:

РЕАКЦИИ ЗАМЕЩЕНИЯ Fe + CuSO4 FeSO4 + Cu ПРОСТОЕ ВЕЩЕСТВО СЛОЖНОЕ ВЕЩЕСТВО Реакциями замещения называют реакции, при которых атомы простого вещества замещают один из элементов в сложном веществе.

№ слайда 14 РЕАКЦИИ ОБМЕНА BaCl2+H2SO4 BaSO4+ 2HCl Реакциями обмена называют реакции, при
Описание слайда:

РЕАКЦИИ ОБМЕНА BaCl2+H2SO4 BaSO4+ 2HCl Реакциями обмена называют реакции, при которых два сложных вещества обмениваются своими составными частями.

№ слайда 15 2KClO3 = 2KCl + 3O2 2Al + 3S = Al2S3 Zn + 2HCl = ZnCl2 + H2 CaCO3 + 2HNO3 =Ca
Описание слайда:

2KClO3 = 2KCl + 3O2 2Al + 3S = Al2S3 Zn + 2HCl = ZnCl2 + H2 CaCO3 + 2HNO3 =Ca(NO3)2 + H2CO3 ОПРЕДЕЛИ ТИП РЕАКЦИИ…

№ слайда 16 ЗАКРЕПИМ! P2O5 + H2O =2HPO3 2Fe(OH)3 = Fe2O3 + 3H2O 2KClO3 = 2KCl + 3O2 2Al +
Описание слайда:

ЗАКРЕПИМ! P2O5 + H2O =2HPO3 2Fe(OH)3 = Fe2O3 + 3H2O 2KClO3 = 2KCl + 3O2 2Al + 3S = Al2S3 Zn + 2HCl = ZnCl2 + H2 Cu(НСО3)2 = CuO + 2CO2+H2O 2HgO = 2Hg + O2 CaCO3+2HNO3=Ca(NO3)2+H2CO3 соединение разложение разложение соединение замещение разложение разложение обмена

№ слайда 17 ОБОБЩИМ! ХИМИЧЕСКИЕ РЕАКЦИИ НОВЫЕ ВЕЩЕСТВА ПРИЗНАКИ цвет газ осадок запах теп
Описание слайда:

ОБОБЩИМ! ХИМИЧЕСКИЕ РЕАКЦИИ НОВЫЕ ВЕЩЕСТВА ПРИЗНАКИ цвет газ осадок запах тепло свет УСЛОВИЯ 1. Нагревание 2.Соприкосновение 3. Катализатор ТИПЫ по числу и составу исходных веществ и продуктов реакции соединения разложения замещения обмена

№ слайда 18 ДОМАШНЕЕ ЗАДАНИЕ § 13, учебник и тетрадь
Описание слайда:

ДОМАШНЕЕ ЗАДАНИЕ § 13, учебник и тетрадь

№ слайда 19 УКАЗАТЬ ТИП ХИМИЧЕСКИХ РЕАКЦИЙ, РАССТАВИТЬ КОЭФФИЦИЕНТЫ. P+O2=P2O5 H2O2= H2O
Описание слайда:

УКАЗАТЬ ТИП ХИМИЧЕСКИХ РЕАКЦИЙ, РАССТАВИТЬ КОЭФФИЦИЕНТЫ. P+O2=P2O5 H2O2= H2O +O2 Ca+O2=CaO Zn+CuSO4=ZnSO4+Cu Na2O+H2O=NaOH Al+O2= Al2O3 K2O+H2O=KOH KNO3=KNO2+O2 FeO+НСl=FeСl2+H2O H2SO4+Al2O3 = Al2(SO4)3+H2O

№ слайда 20 СПАСИБО ЗА ВНИМАНИЕ!
Описание слайда:

СПАСИБО ЗА ВНИМАНИЕ!

Самые низкие цены на курсы профессиональной переподготовки и повышения квалификации!

Предлагаем учителям воспользоваться 50% скидкой при обучении по программам профессиональной переподготовки.

После окончания обучения выдаётся диплом о профессиональной переподготовке установленного образца (признаётся при прохождении аттестации по всей России).

Обучение проходит заочно прямо на сайте проекта "Инфоурок".

Начало обучения ближайших групп: 18 января и 25 января. Оплата возможна в беспроцентную рассрочку (20% в начале обучения и 80% в конце обучения)!

Подайте заявку на интересующий Вас курс сейчас: https://infourok.ru/kursy



Автор
Дата добавления 29.10.2015
Раздел Химия
Подраздел Презентации
Просмотров213
Номер материала ДВ-107901
Получить свидетельство о публикации

УЖЕ ЧЕРЕЗ 10 МИНУТ ВЫ МОЖЕТЕ ПОЛУЧИТЬ ДИПЛОМ

от проекта "Инфоурок" с указанием данных образовательной лицензии, что важно при прохождении аттестации.

Если Вы учитель или воспитатель, то можете прямо сейчас получить документ, подтверждающий Ваши профессиональные компетенции. Выдаваемые дипломы и сертификаты помогут Вам наполнить собственное портфолио и успешно пройти аттестацию.

Список всех тестов можно посмотреть тут - https://infourok.ru/tests

Похожие материалы

Включите уведомления прямо сейчас и мы сразу сообщим Вам о важных новостях. Не волнуйтесь, мы будем отправлять только самое главное.
Специальное предложение
Вверх