Добавить материал и получить бесплатное свидетельство о публикации в СМИ
Эл. №ФС77-60625 от 20.01.2015

Автоматическая выдача свидетельства о публикации в официальном СМИ сразу после добавления материала на сайт - Бесплатно

Добавить свой материал

За каждый опубликованный материал Вы получите бесплатное свидетельство о публикации от проекта «Инфоурок»

(Свидетельство о регистрации СМИ: Эл №ФС77-60625 от 20.01.2015)

Инфоурок / Химия / Другие методич. материалы / Экзаменнационные билеты для 9 класса с углубленным изучением по химии
ВНИМАНИЮ ВСЕХ УЧИТЕЛЕЙ: согласно Федеральному закону № 313-ФЗ все педагоги должны пройти обучение навыкам оказания первой помощи.

Дистанционный курс "Оказание первой помощи детям и взрослым" от проекта "Инфоурок" даёт Вам возможность привести свои знания в соответствие с требованиями закона и получить удостоверение о повышении квалификации установленного образца (180 часов). Начало обучения новой группы: 26 апреля.

Подать заявку на курс
  • Химия

Экзаменнационные билеты для 9 класса с углубленным изучением по химии

библиотека
материалов

Школа-лицей №15 имени Д.И.Менделеева

города Шымкента











ЭКЗАМЕНАЦИОННЫЕ БИЛЕТЫ ДЛЯ 9 КЛАССА

С УГЛУБЛЕННЫМ ИЗУЧЕНИЕМ ХИМИИ







Подготовила учитель химии,

зам.директора по НМР

Жекеева Н.Б.









ШЫМКЕНТ 2014


Билет № 1

1. Осуществите следующие превращения:

Ca3(PO4)2H3PO4K3PO4Ag3PO4

CaCl2CaCO3CaSO4

2. Запишите уравнения гидролиза следующих солей и укажете среду их растворов:

Fe(NO3)3, Cr2(CO3)3

3. Определите вид связи в: CH4, N2, Fe, KBr, OF2, укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

H2SO4(к) + K → K2SO4 + H2S + H2O

5. Дайте характеристику по положению в периодической системе элементу № 16

6. Какой объем газа, измеренный при н.у., выделится, если к раствору массой 230 г с массовой долей

карбоната натрия 15 % прилить раствор массой 220 г с массовой долей хлороводорода 20%.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Fe3+ + 3OH-Fe(OH)3

8. По окончанию электронной формулы определите элемент: …3s2,3p63d6,4s2

9. Оксиды. Определение. Классификация. Получение.

10.Составьте изомеры для С6Н14 и назовите их


Билет № 2

1. Осуществите следующие превращения:

ZnZnSZnOZnCl2Zn(OH)2Na2ZnO2ZnSO4ZnS

2. Запишите уравнения гидролиза следующих солей и укажете среду их растворов: K3PO4, MgS

3. Определите вид связи в: O2,PH3, CaO, AlCl3, CO2, Na укажите тип кристаллической решетки

4. Уравняйте следующую ОВР и укажите число моль окислителя:

5. Дайте характеристику по положению в периодической системе элементу № 13

6. Определите объем раствора NаОН с плотностью 1,2 г/мл, который потребуется для полного осаж-

дения железа в виде гидроксида из раствора массой 300 г с массовой долей хлорида железа (III) 12 %.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

3Ca2+ + 2PO43-Ca3(PO4)2

8. По окончанию электронной формулы определите элемент:…3s2,3p63d5,4s1

9. Способы получения щелочей и нерастворимых оснований.

10.Составьте формулы следующих веществ: 2,2-диметилгексена-3; 2-метилбутадиена-1,2; метилцик-

логексана


Билет № 3

1. Осуществите следующие превращения:

FeFeCl3Fe(OH)3 Fe2O3FeFeCl2HClAgCl

2. Запишите уравнения гидролиза следующих солей и укажете среду их растворов:

NaNO2, K2SiO3

3. Определите вид связи в: CH4, N2, Fe, KBr, OF2, укажите тип кристаллической решетки.

4.Уравняйте следующую ОВР и укажите число моль окислителя:

Cu + HNO3 →Cu(NO3)2 + NO + H2O

5. Дайте характеристику по положению в периодической системе элементу № 15

6 Какой минимальный объем раствора с массовой долей хлороводорода 20% и плотностью 1,1 г/мл.

потребуется для растворения смеси цинка и никеля массой 49г., если массовая доля никеля в смеси

составляет 60,2%?

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Pb2+ +SO42-PbSO4

8. По окончанию электронной формулы определите элемент: …3s2,3p63d6,4s2

9. Кислые соли. Определение. Примеры, названия.

10.Составьте изомеры для С5Н12 и назовите их


Билет № 4

1. Осуществите следующие превращения:

AlAl(OH)3 Al2O3AlAl2(SO4)3Al(OH)3NaAlO2

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

MgS, MgSO4

3. Определите вид связи в: Cl2, HBr, P2O5, Mg, BaCl2, SO2 укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

HCl + KMnO4→ Cl2 + KCl + MnCl2 + H2O

5. Дайте характеристику по положению в периодической системе элементу № 17

6. Какой объем водорода, измеренный при н.у., потребуется для восстановления оксида меди (II), ко-

торый получили при термическом разложении гидроксида меди(II) массой 19,6г.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

S2- + 2H+H2S

8. По окончанию электронной формулы определите элемент: …3s2,3p63d3,4s2

9. Основные оксиды. Примеры. Химические свойства, получение.

10.Определите формулу углеводорода, составьте его изомеры и назовите их, если массовая доля углерода в углеводороде составляет 88,9%, а плотность паров по воздуху равна 1,862


Билет № 5

1. Осуществите следующие превращения:

NaNa2ONaOHCu(OH)2CuSO4ZnSO4

NaOHNa2CO3CO2

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

AgNO3, Li3PO4

3. Определите вид связи в: Mg, SO2, Na2O, I2, BaCl2 укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

NH3 + O2NO + H2O

5. Дайте характеристику по положению в периодической системе элементу № 11

6. К 0,5 л. Раствора с массовой долей серной кислоты 98% и плотностью 1,84г/мл прилили 2л.воды.

Рассчитайте массовую долю кислоты в полученном растворе.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al(OH)3 + 3H+Al3+ + 3H2O

8. По окончанию электронной формулы определите элемент: …3s2,3p3

9. Кислотные оксиды. Примеры. Химические свойства.

10. Алкан имеет плотность по воддуху 4,414. Определите его формулу, составьте изомеры, имеющие

четвертичный и третичный атомы углерода и назовите их

Билет № 6

1. Осуществите следующие превращения:

FeSH2SSO2Na2SO3NaNO3

KHSK2SAg2S

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

Cu(NO3)2, Na2S

3. Определите вид связи в: Сu, CO2, AlBr3, HI,O2 укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

C+ HNO3CO2+ NO + H2O

5. Дайте характеристику по положению в периодической системе элементу № 20

6. К раствору массой 50г с массовой долей хлорида бария 5% прилили раствор массой 50 г

с массовой долей серной кислоты 5%. Определите массу и количество вещества выпавшего осадка.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Ca2+ + CO32- CaCO3

8. По окончанию электронной формулы определите элемент: …4s2, 4p1

9. Электролиты: определение, слабые и сильные, степень диссоциации.

10.Массовая доля углерода в непредельном углеводороде составляет 85,7%, плотность его паров по

воздуху 1,931. Определите формулу, составьте изомеры и назовите их


Билет № 7

1. Осуществите следующие превращения:

ZnZnSZnOZnCl2Zn(OH)2Na2ZnO2ZnSO4ZnS


2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

K2CO3, KCN

3. Определите вид связи в: SiH4, SO3, F2, OF2, Fe, ZnO укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

KNO2 + KClO3KCl + KNO3

5. Дайте характеристику по положению в периодической системе элементу № 34

6. К нитрату серебра массой 13г прилили раствор объемом 41,7мл, плотностью 1,2г/мл с массовой до

лей хлорида натрия 26%. Определите массу и количество вещества выпавшего осадка.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

3Ag+ + PO43-Ag3PO4

8. По окончанию электронной формулы определите элемент: …4s2, 4p5

9. Группы: определение, классификация, изменение свойств, что показывает номер?

10. Массовая доля углерода в углеводороде составляет 83,33%, плотность паров углеводорода по во-

дороду равна 36. определите его формулу, составьте изомеры и назовите их


Билет № 8

1. Осуществите следующие превращения:

KClO3O2BaOBa(OH)2BaCl2BaSO4

H2ONaOHNa3PO4Ag3PO4

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

CuSO4, NaNO2

3. Определите вид связи в: Br2, ZnSO4, Zn, ZnO, PCl5. Покажите механизм образования связи в N2

4.Уравняйте следующую ОВР и укажите число моль восстановителя:

CuO + NH3Cu + N2 + H2O

5. Дайте характеристику по положению в периодической системе элементу № 35

6. В 1291,5 г воды растворили 208,5 г железного купороса FeSO4 · 7H2O . Определите массовую долю

сульфата железа (II) в полученном растворе.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

2Ag+ +S2-Ag2S

8. По окончанию электронной формулы определите элемент:…4s2, 4p3

9. Амфотерные гидроксиды: примеры, химические свойства с точки зрения Э.Д.

10.Составьте формулы следующих веществ: 2,2 диметил-3-этилгептан, 3-метилпентин-1, пропанол-2

Билет № 9

1. Осуществите следующие превращения:

К→ K2OKOHK2CO3KClHClCuCl2Cu

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

Zn(NO3)2, Na2S

3. Определите вид связи в: I2, K2SO4, Cu, CaO, CO2. Покажите механизм образования связи в I2

4.Уравняйте следующую ОВР и укажите число моль восстановителя:

HI + H2SO4I2 + H2S + H2O

5. Дайте характеристику по положению в периодической системе элементу № 14

6. Смешали 200мл 15% раствора соляной кислоты с плотностью 1,3г/мл и 300 мл 20% раствора соля-

ной кислоты с плотностью 1,1 г/мл. Определите массовую долю кислоты в полученном растворе

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Pb2+ + SO42-PbSO4

8. По окончанию электронной формулы определите элемент: …2S22p4

9. Дайте определение орбитали, какие формы орбитали вам известны, каково максимальное число

электронов может находиться на определенном виде орбитали?

10.Составьте формулы следующих веществ: 1,3 диметил-бензол, бутадиен-1,2 бутанол-1


Билет № 10

1. Осуществите следующие превращения:

CCH4CO2K2CO3 KClHClAlCl3Al(OH)3NaAlO2AlCl3

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

CrCl3, CuSO4

3. Определите тип кристаллической решетки в : I2, K2SO4, Cu, CaO, CO2 , что можно сказать об

агрегатном состоянии и свойствах перечисленных веществ?

4.Уравняйте следующую ОВР и укажите сумму всех коэффициентов:

H2O + P + HNO3NO + H3PO4

5. Дайте характеристику по положению в периодической системе элементу № 19

6. Через раствор гидроксида натрия объемом 144,1 мл, плотностью 1,11 г/мл с массовой долей

10% пропустили сероводород объемом 4,48л(н.у.). Какая соль и какой массы образуется при этом?

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

S2- + Cu2+CuS

8. По окончанию электронной формулы определите элемент: …3s2,3p6, 3d74s2

9. Ковалентная связь: виды, примеры.

10. Массовая доля углерода в углеводороде составляет 84,21%, плотность его паров по

воздуху 3,93. Определите формулу, составьте изомеры и назовите их

Билет № 11

1. Осуществите следующие превращения:

PCa3P2P2O5H3PO4Ca3(PO4)2CaCl2CaS H2SKHS

2. Запишите уравнения ступенчатого гидролиза и укаиете среду раствора Al(NO3)3

3. Определите тип кристаллической решетки в CO2, Mg, KBr, что можно сказать о

агрегатном состоянии и свойствах перечисленных веществ?

4.Уравняйте следующую ОВР и укажите сумму всех коэффициентов:

Zn + HNO3 → Zn(NO3)2 + NH3 + H2O

5. Дайте характеристику по положению в периодической системе элементу № 17

6. К 0,5л раствора серной кислоты с массовой долей 98% и плотностью 1,84г/мл прилили

2л воды. Рассчитайте массовую долю кислоты в полученном растворе.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

FeS + 2H+Fe2+ + H2S

8. По окончанию электронной формулы определите элемент: …3s2,3p6, 3d54s2

9. Ионная связь: примеры, способы образования

10. Составьте формулу 2,4,5,5тетраиметил-3-этилоктана. Укажите все первичные, вторичные, третич-

ные и четвертичные атомы углерода.


Билет № 12

1. Осуществите следующие превращения:

SiSiO2K2SiO3H2SiO3

Mg2SiMgCl2Mg(OH)2Mg3(PO4)2

2. Запишите уравнения ступенчатого гидролиза и укажите среду раствора Na3PO4

3. Определите тип кристаллической решетки в :H2O, Cu. NaCl. C, что можно сказать о

агрегатном состоянии и свойствах перечисленных веществ?

4.Уравняйте следующую ОВР и укажите сумму всех коэффициентов:

Na + HNO3NaNO3 + N2O + H2O

5. Дайте характеристику по положению в периодической системе элементу № 13

6. Смешали 200мл 15% раствора соляной кислоты с плотностью 1,3г/мл и 300 мл 20% раствора

соляной кислоты с плотностью 1,1г/мл. Определите массовую долю кислоты в полученном

растворе.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент: …3s2,3p5

9. Водородная связь: определение, примеры.

10. Массовая доля углерода в углеводороде составляет 85,7% .5,25г этого вещества занимают объем

2,8л при н.у. Определите формулу углеводорода, назовите его и составьте его изомеры

Билет № 13

1. Осуществите следующие превращения:

FeFe2(SO4)3Fe(OH)3Fe2O3FeFeSH2SSO2SO3H2SO4

Na2SO4 BaSO4

2. Запишите уравнения ступенчатого гидролиза и укажите среду раствора Fe(NO3)3

3. Определите тип кристаллической решетки в Cu, KCl, H2S, Si, что можно сказать о

агрегатном состоянии и свойствах перечисленных веществ?

4.Уравняйте следующую ОВР и укажите сумму всех коэффициентов:

Fe + HNO3 → Fe(NO3)3 + NO2 + H2O

5. Дайте характеристику по положению в периодической системе элементу № 25

6. Сероводород объемом 8,96 л (н.у.) растворили в воде массой 100 гр. Определите массовую долю

растворенного вещества (ώ) в полученном растворе

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

CaCO3 + 2H+ Ca2+ + CO2 + H2O

8. По окончанию электронной формулы определите элемент:…3s2,3p63d4,4s2

9. Кислоты: определение с точки зрения Э.Д.

10. Составьте изомеры для С6Н14 и назовите их


Билет № 14

1. Осуществите следующие превращения:

CuSCuOCuSO4CuSH2SSO2Na2SO3SO2

2. Запишите уравнения ступенчатого гидролиза и укажете среду раствора K2CO3

3. Определите вид связи в Cl2, HCl ,Ag ,KCl, CO2 . Покажите механизм образования связи в HCl

4.Уравняйте следующую ОВР и укажите сумму всех коэффициентов:

Cl2 + Br2 + KOH → KCl + KBrO3 + H2O

5. Дайте характеристику по положению в периодической системе элементу № 29

6. Смесь, состоящую из магния и оксида магния, массой 10 гр. обработали разбавленной серной

кислотой, при этом выделился газ объемом 5,6 л (н.у.). Определите массовую долю

магния в смеси

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Сa2+ + CO32-CaCO3

8. По окончанию электронной формулы определите элемент: …3s2,3p6,4s1

9. Степень окисления: определение, какие значения может принимать?

10. Составьте формулы следующих веществ: 2,2-диметилгексена-3; 2-метилбутадиена-1,2; метилцик-

логексана

Билет № 15

1. Осуществите следующие превращения:

KKOHKHSK2SH2SSO2Na2SO3 NaClAgCl

2. Запишите уравнения гидролиза и укажите среду растворa Na2SO3

3. Определите вид связи в: CO2, NH3, Fe, CaBr2, F2, укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

Cu + HNO3 →Cu(NO3)2 + NO + H2O

5. Дайте характеристику по положению в периодической системе элементу № 16

6. Из раствора гидроксида калия массой 1кг с массовой долей 16% выпарили 200г воды. Определите

массовую долю гидроксида калия в полученном растворе.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент…3s2,3p63d10,4s2

9. Дайте определение гидролизу, какие соли гидролизу подвергаются?

10.Составьте изомеры для С5Н12 и назовите их




Билет № 16

1. Осуществите следующие превращения:

BaBaOBa(OH)2BaCl2Ba3(PO4)2H3PO4KH2PO4 K2HPO4K3PO4Ag3PO4

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

Na2SiO3 , CuSO4

3. Определите вид связи в: KBr, F2, H2O, CaO, Cu, укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

Cl2 + H2S + H2OHCl + H2SO4

5. Дайте характеристику по положению в периодической системе элементу № 9

6. В воде массой 50г растворили медный купорос CuSO4 ·5H2O массой 3,5г. Рассчитайте массовую

долю сульфата меди (II) в полученном растворе.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент:…3s2,3p63d10,4s2

9. Современная формулировка периодического закона.

10.Определите формулу углеводорода, составьте его изомеры и назовите их, если массовая доля углерода в углеводороде составляет 88,9%, а плотность паров по воздуху равна 1,862


Билет № 17

1. Осуществите следующие превращения:

FeFeCl3Fe(OH)3Fe2O3Fe2(SO4)3FeFeSH2SNaHSNa2SCuS

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

MgS, K2S

3. Определите вид связи в: O2NH3, Fe, CaBr2, F2, укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

I2 + Cl2 + H2OHIO3 + HCl

5. Дайте характеристику по положению в периодической системе элементу №35

6. Имеются растворы с массовой долей гидроксида натрия 20 и 10%. Какую массу каждого раствора

надо взять для получения раствора с массовоц долец соли 12% массой 300г?

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент: …3s2,3p63d10,4s2

9. Сильные и слабые электролиты, степень Э.Д.

10. Алкан имеет плотность по воддуху 4,414. Определите его формулу, составьте изомеры, имеющие

четвертичный и третичный атомы углерода и назовите их


Билет № 18

1. Осуществите следующие превращения:

CCO2K2CO3CaCO3CaCl2AgCl

CH4 CO2MgCO3MgO

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

NaF, FeCl3

3. Определите вид связи в: SO2, PH3, Ca, BaBr2, Cl2, укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

Zn + HNO3 →Zn(NO3)2 + N2 + H2O

5. Дайте характеристику по положению в периодической системе элементу № 26

6. Определите молярную концентрацию раствора, полученного при растворении сульфата натрия

массой 300г, если плотность полученного раствора равна 1,12г/мл.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент …3s2,3p63d10,4s2

9. Электроотрицательность: определение, как она изменяется в периоде и подгруппе?

10.Массовая доля углерода в непредельном углеводороде составляет 85,7%, плотность его паров по

воздуху 1,931. Определите формулу, составьте изомеры и назовите их



Билет № 19

1. Осуществите следующие превращения:

SO3 CuSO4ZnSO4Zn(OH)2Na2ZnO2ZnCl2ZnSZnOZn

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

K2SO3, Cu(NO3)2

3. Определите вид связи в: O2, NH3, KI, Mg, H2, укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

P + KOH + H2OPH3 + KH2PO4

5. Дайте характеристику по положению в периодической системе элементу № 17

6. Какая масса осадка образуется, если пропустить оксид углерода (IV) объемом 280мл (н.у.) через

раствор гидроксида бария массой 20г с массовой долей 12%?

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент:…3s2,3p63d10,4s2

9. Реакции ионного обмена, условия протекания до конца.

10.Составьте формулы следующих веществ: 2,2 диметил-3-этилгептан, 3-метилпентин-1, пропанол-2


Билет № 20

1. Осуществите следующие превращения:

Cl2HClH2H2OAl(OH)3Al2O3Al2(SO4)3BaSO4

2. Запишите уравнения гидролиза следующих солей и укаите среду их растворов:

FeSO4, Na2S

3. Определите вид связи в: Zn, CuCl2, Na2O, Cl2, H2S, CO2 укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

Na2SO3Na2S + Na2SO4

5. Дайте характеристику по положению в периодической системе элементу № 15

6. Массовая доля фосфора в оксиде фосфора равна 44%.Относительная плотность оксида по

воздуху 9,97.Определите формулу оксида.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент: …3s2,3p63d10,4s2

9. Окислительно-восстановительные реакции: определение. Процессы окисления, восстановления.

Окислитель, восстановитель.

10.Составьте формулы следующих веществ: 1,3 диметил-бензол, бутадиен-1,2 бутанол-1


Билет № 21

1. Осуществите следующие превращения:

CaCa3P2PH3 P2O5K3PO4Ca3(PO4)2H3PO4Ag3PO4

2. Запишите уравнения гидролиза следующих солей и укажие среду их растворов:

AlCl3, KF

3. Определите вид связи в: N2, NO2, NH3, CaO, ZnF2, Zn

4.Уравняйте следующую ОВР и укажите число моль окислителя:

Pb(NO3)2PbO + NO2 + O2

5. Дайте характеристику по положению в периодической системе элементу № 14

6. В результате реакции между железом массой2,4г и хлором объемом 15,68л (н.у.)

получили хлорид железа(III), который растворили в воде массой 500г. Определите массовую

долю соли в полученном растворе.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент: …3s2,3p63d10,4s2

9. Что показывает порядковый номер элемента? Как определить число нейтронов?

10.Составьте изомеры для С8Н18 и назовите их





Билет № 22

1. Осуществите следующие превращения:

MgMgOMgCO3MgCl2Mg(OH)2MgCO3MgOMg(OH)2MgOHClMgCl2

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

Al2S3, Zn(NO3)2

3. Определите вид связи в: NH3, O2, Mg, FeCl3, F2

4.Уравняйте следующую ОВР и укажите число моль окислителя:

P + HNO3 + H2OH3PO4 + NO

5. Дайте характеристику по положению в периодической системе элементу № 13

6. Определите формулу оксида азота, содержащего 25,9%N и 74,1%О, плотность которого по водороду

равна 54.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент:…3s2,3p63d10,4s2

9. Чему равно количество вещества для твердых и жидких веществ, для газов?

10.Составьте формулы следующих веществ: 1,4 диметил-бензол, 2-метилбутадиен-1,2 бутанол-2


Билет № 23

1. Осуществите следующие превращения:

CCH4CO2K2CO3CaCO3CaOCa(OH)2CaCO3CaSO4

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

KNO2, ZnSO4

3. Определите вид связи в: Au, H2, HI, CuO, CuCl2, укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

NH3 + O2 N2 + H2O

5. Дайте характеристику по положению в периодической системе элементу № 12

6. Какой объем сероводорода, измеренного при (н.у.), можно получить из технического сульфида же-

леза массой 3кг, массовая доля FeS в котором составляет 95%?

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент:…3s2,3p63d10,4s2

9. Металлическая связь: определение, примеры.

10. Углеводород, плотность паров которого по водороду равна 15, содержит 80% углерода. Найдите

его молекулярную формулу.


Билет № 24

1. Осуществите следующие превращения:

PP2O5K3PO4Ca3(PO4)2H3PO4H2H2OH2SO4BaSO4

2. Запишите уравнения гидролиза и укажите среду растворa Cu(NO3)2

3. Определите вид связи в: HF, F2, NaF, Al , укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

S + HNO3 H2SO4 + NO2 + H2O

5. Дайте характеристику по положению в периодической системе элементу № 11

6. Определите массовую долю вещества в растворе, полученном смешением 300г 25%-ного и 400г

40%-ного растворов этого вещества.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент:

3s2,3p63d10,4s2

9. Дайте определение, ковалентной полярной связи, что можно сказать о нахождении общей

электронной пары?

10. Массовая доля углерода в углеводороде составляет 82,76%. При нормальных условиях 10л этого газа имеют массу 25,88 г. Найдите его молекулярную формулу, составьте его изомеры и назовите их



Билет № 25

1. Осуществите следующие превращения:

NaNaClHClCuCl2Cu(OH)2CuOCuCuSCuSO4FeSO4

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

ZnSO4, KNO2

3. Определите вид связи в: P2O5, Cl2, H2S, SC, MgO, Mg укажите тип кристаллической ре-

шетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

NO2 + H2OHNO3 + NO

5. Дайте характеристику по положению в периодической системе элементу № 19

6. Какой объем газа, измеренный при (н.у.) выделится, если к раствору массой 230 г с массовой долей

карбоната натрия 15 %, прилить раствор массой 220 г с массовой долей хлороводорода 20 %.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент: …3s2,3p63d10,4s2

9. При каких условиях реакции ионного обмена протекают до конца?

10. Алкан имеет плотность по воддуху 4,414. Определите его формулу, составьте изомеры, имеющие

четвертичный и третичный атомы углерода и назовите их


Билет № 26

1. Осуществите следующие превращения:

SSO2K2SO3BaSO3BaOBa(OH)2BaCO3BaCl2AgCl

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

Na2CO3, NaCN

3. Определите вид связи в: Br2, HBr, CaBr2, Ca укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

Cl2 + KOHKCl + KClO3 + H2O

5. Дайте характеристику по положению в периодической системе элементу № 20

6. Какой объем водорода, измеренный при нормальных условиях, выделится при действии на алюми

ний массой 32,1 г раствора объемом 200 мл с массовой долей гидроксида калия 30 % и плотностью

1,29 г/мл

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент:…3s2,3p63d10,4s2

9. Дайте определение электролитической диссоциации

10. Составьте формулы следующих веществ: 1,4 диметил-бензол, 2-метилбутадиен-1,2 бутанол-2


Билет № 27

1. Осуществите следующие превращения:

CaOCaCO3CaOCa(OH)2Ca3(PO4)2H3PO4K3PO4Ag3PO4

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

K2S, CuCl2

3. Определите вид связи в: H2O, CH4, Fe, BaBr2, F2, укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

Fe + H2SO4 →Fe2(SO4)3 + SO2 + H2O

5. Дайте характеристику по положению в периодической системе элементу № 30

6. Сероводород объемом 5,6 л (н.у.) пропустили через 69,8 мл раствора с массовой долей КОН

17,3 % и плотностью 1,16 г/мл. Найти массу и количество вещества полученной соли.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент:…3s2,3p63d10,4s2

9. Дайте определение солям с точки зрения Э.Д.

10. Составьте изомеры для С8Н18 и назовите их



Билет № 28

1. Осуществите следующие превращения:

Al→Al2O3→X→Al(OH)3→ Al2O3→Al→Al4C3→ Al(OH)3→Al2(SO4)3

2. Запишите уравнения гидролиза и укажите среду растворa Fe(NO3)3

3. Определите вид связи в: O2, NH3, Fe2O3, Ca, HBr, F2, укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

CuS + HNO3CuSO4 +NO2 + H2O

5. Дайте характеристику по положению в периодической системе элементу № 34

6. При охлаждении 150 гр. 40%-ного раствора выпало в осадок 15 гр. вещества. Осадок отфильтрова-

ли и удалили. Определите концентрацию полученного раствора.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент:…3s2,3p63d10,4s2

9. Дайте определение кислотам с точки зрения Э.Д.

10. Составьте формулы следующих веществ: 2,2-диметилгексена-3; 2-метилбутадиена-1,2; метилцик-

логексана


Билет № 29

1. Осуществите следующие превращения:

FeFe2O3Fe2(SO4)3Fe(OH)3Fe2O3FeFeSH2S

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

K3PO4, MgS

3. Определите вид связи в: CO2, NH3, Fe, CaBr2, F2, укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

KI + HNO3 →I2 + KNO3 + NO + H2O

5. Дайте характеристику по положению в периодической системе элементу № 33

6. При взаимодействии раствора серной кислоты массой 16г с избытком раствора хлорида бария выде-

лился осадок массой 5,7г. Определите массовую долю серной кислоты в исходном растворе.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент: …3s2,3p63d10,4s2

9. Дайте определение основаниям с точки зрения Э.Д.

10. Углеводород, плотность паров которого по водороду равна 15, содержит 80% углерода. Найдите

его молекулярную формулу.

Билет № 30

1. Осуществите следующие превращения:

MgCO3→MgO→Mg(OH)2→MgCl2→Mg3(PO4)2→H3PO4→Ag3PO4

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

NaNO2, K2SiO3

3. Определите вид связи в: CO2, NH3, Fe, CaBr2, F2, укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

P +KClO3 P2O5 + KCl

5. Дайте характеристику по положению в периодической системе элементу № 25

6. Какой объем углекислого газа необходимо пропустить при(н.у.) через раствор массой 80г с массо-

вой долей гидроксида бария 5% для получения карбоната бария

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент: …3s2,3p63d10,4s2

9. Периоды: классификация, изменение свойств.

10. Массовая доля углерода в углеводороде составляет 82,76%. При нормальных условиях 10л этого газа имеют массу 25,88 г. Найдите его молекулярную формулу, составьте его изомеры и назовите их






Билет № 31

1. Осуществите следующие превращения:

CuCuSCuSO4Cu(OH)2CuOHClCuCl2Cu

2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:

MgS, MgSO4

3. Определите вид связи в: CO2, NH3, Fe, CaBr2, F2, укажите тип кристаллической решетки

4.Уравняйте следующую ОВР и укажите число моль окислителя:

CaI2 + H2SO4 →CaSO4 + I2 + H2S + H2O

5. Дайте характеристику по положению в периодической системе элементу № 13

6. Определите массовую долю гидроксида бария в растворе, полученном при смешении воды массой

50г и оксида бария массой 1,2г.

7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение

Al3+ + 3OH-Al(OH)3

8. По окончанию электронной формулы определите элемент: …3s2,3p63d10,4s2

9. Состав кислых солей, примеры, названия.

10.Составьте изомеры для С8Н18 и назовите их





Краткое описание документа:

                                                                  Билет № 1 1. Осуществите следующие превращения:     Ca3(PO4)2→H3PO4→ K3PO4 →Ag3PO4 ë CaCl2→CaCO3→CaSO4 2. Запишите уравнения гидролиза следующих солей и укажете среду их растворов:     Fe(NO3)3, Cr2(CO3)3 3. Определите вид связи в: CH4, N2, Fe, KBr, OF2, укажите тип кристаллической решетки 4.Уравняйте следующую ОВР и укажите число моль окислителя:     H2SO4(к) + K → K2SO4 +  H2S + H2O 5. Дайте характеристику по положению в периодической системе элементу № 16 6. Какой объем газа, измеренный при н.у., выделится,  если к раствору массой 230 г с массовой долей     карбоната натрия 15 % прилить раствор массой 220 г с массовой  долей  хлороводорода 20%.                7.  По краткому ионному уравнению составьте молекулярное и полное ионное уравнение       Fe3+ + 3OH-→Fe(OH)3 8. По окончанию электронной формулы определите элемент:  …3s2,3p63d6,4s2   9. Оксиды. Определение. Классификация. Получение. 10.Составьте изомеры для С6Н14 и назовите их                                                                           Билет № 2 1. Осуществите следующие превращения:    Zn → ZnS → ZnO → ZnCl2 →Zn(OH)2 → Na2ZnO2 → ZnSO4 → ZnS   2. Запишите уравнения гидролиза следующих солей и укажете среду их растворов:  K3PO4, MgS 3. Определите вид связи в:  O2,PH3, CaO, AlCl3, CO2, Na  укажите тип  кристаллической  решетки 4. Уравняйте следующую ОВР и укажите число моль окислителя: 5. Дайте характеристику по положению в периодической системе элементу № 13 6. Определите объем раствора  NаОН с плотностью 1,2 г/мл, который потребуется для полного  осаж-     дения железа в виде гидроксида из раствора массой 300 г с массовой долей хлорида  железа (III) 12 %. 7.  По краткому ионному уравнению составьте молекулярное и полное ионное уравнение         3Ca2+ + 2PO43-→ Ca3(PO4)2 8.  По окончанию электронной формулы определите элемент:…3s2,3p63d5,4s1    9.  Способы получения щелочей и нерастворимых оснований. 10.Составьте формулы следующих веществ: 2,2-диметилгексена-3; 2-метилбутадиена-1,2; метилцик-      логексана   Билет № 3 1. Осуществите следующие превращения:   Fe → FeCl3→ Fe(OH)3 → Fe2O3 →  Fe → FeCl2→HCl→  AgCl   2. Запишите уравнения гидролиза следующих солей и укажете среду их растворов:         NaNO2, K2SiO3 3. Определите вид связи в: CH4, N2, Fe, KBr, OF2, укажите тип кристаллической решетки. 4.Уравняйте следующую ОВР и укажите число моль окислителя:     Cu + HNO3 →Cu(NO3)2 + NO + H2O 5. Дайте характеристику по положению в периодической системе элементу № 15 6 Какой минимальный объем раствора с массовой долей хлороводорода 20%  и  плотностью 1,1 г/мл.   потребуется для растворения смеси цинка и никеля массой 49г., если массовая доля никеля в смеси   составляет 60,2%? 7.  По краткому ионному уравнению составьте молекулярное и полное ионное уравнение        Pb2+ +SO42- →PbSO4 8. По окончанию электронной формулы определите элемент: …3s2,3p63d6,4s2   9.  Кислые соли. Определение. Примеры, названия. 10.Составьте изомеры для С5Н12 и назовите их     Билет № 4 1. Осуществите следующие превращения:     Al→ Al(OH)3 → Al2O3 → Al →  Al2(SO4)3 → Al(OH)3→ NaAlO2 2. Запишите уравнения гидролиза следующих солей и укажите среду их растворов:     MgS, MgSO4 3. Определите вид связи в: Cl2, HBr, P2O5, Mg, BaCl2, SO2 укажите тип кристаллической  решетки 4.Уравняйте следующую ОВР и укажите число моль окислителя:     HCl + KMnO4→ Cl2 + KCl + MnCl2 + H2O 5. Дайте характеристику по положению в периодической системе элементу № 17 6. Какой объем водорода, измеренный при н.у., потребуется для восстановления оксида меди (II), ко-    торый получили при термическом разложении гидроксида меди(II) массой 19,6г. 7. По краткому ионному уравнению составьте молекулярное и полное ионное уравнение S2- + 2H+ →H2S 8. По окончанию электронной формулы определите элемент: …3s2,3p63d3,4s2   9.  Основные оксиды. Примеры. Химические свойства, получение. 10.Определите формулу углеводорода, составьте его изомеры и назовите их, если массовая доля углерода в углеводороде составляет 88,9%, а плотность паров по воздуху равна 1,862                                                                                                            
Автор
Дата добавления 11.04.2014
Раздел Химия
Подраздел Другие методич. материалы
Просмотров875
Номер материала 66103041146
Получить свидетельство о публикации

"Инфоурок" приглашает всех педагогов и детей к участию в самой массовой интернет-олимпиаде «Весна 2017» с рекордно низкой оплатой за одного ученика - всего 45 рублей

В олимпиадах "Инфоурок" лучшие условия для учителей и учеников:

1. невероятно низкий размер орг.взноса — всего 58 рублей, из которых 13 рублей остаётся учителю на компенсацию расходов;
2. подходящие по сложности для большинства учеников задания;
3. призовой фонд 1.000.000 рублей для самых активных учителей;
4. официальные наградные документы для учителей бесплатно(от организатора - ООО "Инфоурок" - имеющего образовательную лицензию и свидетельство СМИ) - при участии от 10 учеников
5. бесплатный доступ ко всем видеоурокам проекта "Инфоурок";
6. легко подать заявку, не нужно отправлять ответы в бумажном виде;
7. родителям всех учеников - благодарственные письма от «Инфоурок».
и многое другое...

Подайте заявку сейчас - https://infourok.ru/konkurs


Выберите специальность, которую Вы хотите получить:

Обучение проходит дистанционно на сайте проекта "Инфоурок".
По итогам обучения слушателям выдаются печатные дипломы установленного образца.

ПЕРЕЙТИ В КАТАЛОГ КУРСОВ


Идёт приём заявок на международный конкурс по математике "Весенний марафон" для учеников 1-11 классов и дошкольников

Уникальность конкурса в преимуществах для учителей и учеников:

1. Задания подходят для учеников с любым уровнем знаний;
2. Бесплатные наградные документы для учителей;
3. Невероятно низкий орг.взнос - всего 38 рублей;
4. Публикация рейтинга классов по итогам конкурса;
и многое другое...

Подайте заявку сейчас - https://urokimatematiki.ru

Похожие материалы

Включите уведомления прямо сейчас и мы сразу сообщим Вам о важных новостях. Не волнуйтесь, мы будем отправлять только самое главное.
Специальное предложение
Вверх